Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Zeolite ZSM-5, ammonium
CAS: 1318-02-1 Molecular Formula: Al2O5Si Molecular Weight (g/mol): 162.043 MDL Number: MFCD00132601 InChI Key: HNPSIPDUKPIQMN-UHFFFAOYSA-N Synonym: kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural PubChem CID: 9942228 IUPAC Name: dioxosilane;oxo(oxoalumanyloxy)alumane SMILES: O=[Al]O[Al]=O.O=[Si]=O
| PubChem CID | 9942228 |
|---|---|
| CAS | 1318-02-1 |
| Molecular Weight (g/mol) | 162.043 |
| MDL Number | MFCD00132601 |
| SMILES | O=[Al]O[Al]=O.O=[Si]=O |
| Synonym | kaolinite,montmorillonite aluminum pillared clay,silica-alumina catalyst support, grade 135,aidplusocma,bactekillermb,fiberfrax™,bactekillerbm101a,bactekillerbm102a,bactekillerbm501a,kaolinite, natural |
| IUPAC Name | dioxosilane;oxo(oxoalumanyloxy)alumane |
| InChI Key | HNPSIPDUKPIQMN-UHFFFAOYSA-N |
| Molecular Formula | Al2O5Si |
Nickel wire, 0.15mm (0.006in) dia, annealed, Nickel 200, approximately 99% (metals basis)
CAS: 7440-02-0 Molecular Formula: Ni Molecular Weight (g/mol): 58.69 MDL Number: MFCD00011137 MFCD06798735 InChI Key: PXHVJJICTQNCMI-UHFFFAOYSA-N Synonym: raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum PubChem CID: 935 ChEBI: CHEBI:28112 IUPAC Name: nickel SMILES: [Ni]
| PubChem CID | 935 |
|---|---|
| CAS | 7440-02-0 |
| Molecular Weight (g/mol) | 58.69 |
| ChEBI | CHEBI:28112 |
| MDL Number | MFCD00011137 MFCD06798735 |
| SMILES | [Ni] |
| Synonym | raney alloy,fibrex,catalyst,particles,fibrex p,nickel, elemental,nichel italian,nickel, soluble salts,carbonyl powder,niccolum |
| IUPAC Name | nickel |
| InChI Key | PXHVJJICTQNCMI-UHFFFAOYSA-N |
| Molecular Formula | Ni |
Aluminum Ammonium Sulfate, Dodecahydrate, Crystal, ACS, 98-102%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 7784-26-1
| CAS | 7784-26-1 |
|---|
Magnesium silicate, 99% (metals basis)
CAS: 1343-88-0 Molecular Formula: MgO3Si Molecular Weight (g/mol): 100.39 MDL Number: MFCD00078249 InChI Key: ZADYMNAVLSWLEQ-UHFFFAOYSA-N
| CAS | 1343-88-0 |
|---|---|
| Molecular Weight (g/mol) | 100.39 |
| MDL Number | MFCD00078249 |
| InChI Key | ZADYMNAVLSWLEQ-UHFFFAOYSA-N |
| Molecular Formula | MgO3Si |
Aluminum Thinfoil, 2.0 micron (0.00008 in.) thick, 99.1% (metals basis), Thermo Scientific Chemicals
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Sodium oxalate, ACS, 99.5+%
CAS: 62-76-0 Molecular Formula: C2Na2O4 Molecular Weight (g/mol): 134.00 MDL Number: MFCD00012465 InChI Key: ZNCPFRVNHGOPAG-UHFFFAOYSA-L Synonym: sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt PubChem CID: 6125 IUPAC Name: disodium;oxalate SMILES: [Na+].[Na+].[O-]C(=O)C([O-])=O
| PubChem CID | 6125 |
|---|---|
| CAS | 62-76-0 |
| Molecular Weight (g/mol) | 134.00 |
| MDL Number | MFCD00012465 |
| SMILES | [Na+].[Na+].[O-]C(=O)C([O-])=O |
| Synonym | sodium oxalate,disodium oxalate,natriumoxalat,ethanedioic acid, disodium salt,oxalic acid, disodium salt,natriumoxalat german,stavelan sodny czech,oxalic acid disodium salt,unii-7u0v68lt9x,ethanedioic acid disodium salt |
| IUPAC Name | disodium;oxalate |
| InChI Key | ZNCPFRVNHGOPAG-UHFFFAOYSA-L |
| Molecular Formula | C2Na2O4 |
Potassium tin(IV) oxide trihydrate, 95%
CAS: 12125-03-0 Molecular Formula: H6K2O6Sn Molecular Weight (g/mol): 298.95 MDL Number: MFCD00150391 InChI Key: HTHDWDSBYOUAFF-UHFFFAOYSA-N Synonym: potassium stannate trihydrate,unii-r38y86o4sy,2k.so3n.3h2o,potassium tin iv oxide trihydrate,dipotassium dioxido oxo tin trihydrate,dipotassium ion oxostannanebis olate trihydrate,dipotassium oxostannanebis olate trihydrate,dipotassium bis oxidanidyl-oxidanylidene-tin trihydrate PubChem CID: 18694711 IUPAC Name: dipotassium;dioxido(oxo)tin;trihydrate SMILES: O.O.O.[K+].[K+].[O-][Sn]([O-])=O
| PubChem CID | 18694711 |
|---|---|
| CAS | 12125-03-0 |
| Molecular Weight (g/mol) | 298.95 |
| MDL Number | MFCD00150391 |
| SMILES | O.O.O.[K+].[K+].[O-][Sn]([O-])=O |
| Synonym | potassium stannate trihydrate,unii-r38y86o4sy,2k.so3n.3h2o,potassium tin iv oxide trihydrate,dipotassium dioxido oxo tin trihydrate,dipotassium ion oxostannanebis olate trihydrate,dipotassium oxostannanebis olate trihydrate,dipotassium bis oxidanidyl-oxidanylidene-tin trihydrate |
| IUPAC Name | dipotassium;dioxido(oxo)tin;trihydrate |
| InChI Key | HTHDWDSBYOUAFF-UHFFFAOYSA-N |
| Molecular Formula | H6K2O6Sn |
Sodium chloride, Spectroscopy Grade
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M Synonym: sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex PubChem CID: 5234 ChEBI: CHEBI:26710 IUPAC Name: sodium chloride SMILES: [Na+].[Cl-]
| PubChem CID | 5234 |
|---|---|
| CAS | 7647-14-5 |
| Molecular Weight (g/mol) | 58.44 |
| ChEBI | CHEBI:26710 |
| MDL Number | MFCD00003477 |
| SMILES | [Na+].[Cl-] |
| Synonym | sodium chloride,salt,table salt,halite,saline,rock salt,common salt,sodium chloride nacl,dendritis,purex |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
Zinc iodide, ultra dry, 99.995% (metals basis)
CAS: 10139-47-6 Molecular Formula: ZnI2 MDL Number: MFCD00011299
| CAS | 10139-47-6 |
|---|---|
| MDL Number | MFCD00011299 |
| Molecular Formula | ZnI2 |
Indium foil, 1.0mm (0.04in) thick, Puratronic™, 99.998% (metals basis)
CAS: 7440-74-6 Molecular Formula: In Molecular Weight (g/mol): 114.82 MDL Number: MFCD00134048 InChI Key: APFVFJFRJDLVQX-UHFFFAOYSA-N Synonym: indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic PubChem CID: 5359967 ChEBI: CHEBI:30430 IUPAC Name: indium SMILES: [In]
| PubChem CID | 5359967 |
|---|---|
| CAS | 7440-74-6 |
| Molecular Weight (g/mol) | 114.82 |
| ChEBI | CHEBI:30430 |
| MDL Number | MFCD00134048 |
| SMILES | [In] |
| Synonym | indium, elemental,unii-045a6v3vfx,powder,shot,powder,-100 mesh,indio,shot, tear drop, 4mm 0.2in,ingot, polycrystalline, puratronic,shot, 5mm 0.2in & down, puratronic,wire, 0.5mm 0.02in dia, puratronic |
| IUPAC Name | indium |
| InChI Key | APFVFJFRJDLVQX-UHFFFAOYSA-N |
| Molecular Formula | In |
Silica G-TLC, MP Biomedicals™
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Potassium trioxalatoferrate(III) trihydrate
CAS: 5936-11-8 Molecular Formula: C6H3FeK3O12 Molecular Weight (g/mol): 440.22 MDL Number: MFCD00150450 InChI Key: YXTWCYYDGRBUDE-UHFFFAOYSA-K Synonym: Potassium iron(III) oxalate PubChem CID: 131675837
| PubChem CID | 131675837 |
|---|---|
| CAS | 5936-11-8 |
| Molecular Weight (g/mol) | 440.22 |
| MDL Number | MFCD00150450 |
| Synonym | Potassium iron(III) oxalate |
| InChI Key | YXTWCYYDGRBUDE-UHFFFAOYSA-K |
| Molecular Formula | C6H3FeK3O12 |
Magnesium oxide, Puriss., meets analytical spec. of BP, FCC, Ph. Eur., USP, E 530, light, 98.0-100.5% (calc. for dried substance), Honeywell Fluka™
CAS: 1309-48-4 Molecular Formula: MgO Molecular Weight (g/mol): 40.30 MDL Number: MFCD00011109 InChI Key: CPLXHLVBOLITMK-UHFFFAOYSA-N Synonym: magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag PubChem CID: 14792 IUPAC Name: oxomagnesium SMILES: O=[Mg]
| PubChem CID | 14792 |
|---|---|
| CAS | 1309-48-4 |
| Molecular Weight (g/mol) | 40.30 |
| MDL Number | MFCD00011109 |
| SMILES | O=[Mg] |
| Synonym | magnesium oxide,magnesia,seawater magnesia,causmag,granmag,maglite,periclase,seasorb,animag |
| IUPAC Name | oxomagnesium |
| InChI Key | CPLXHLVBOLITMK-UHFFFAOYSA-N |
| Molecular Formula | MgO |
Calcium sulfate dihydrate, Puriss., meets analytical spec. of NF, E 516, 99.0-101.0% (based on anhydrous substance), Honeywell Fluka™
CAS: 10101-41-4 Molecular Formula: CaH4O6S Molecular Weight (g/mol): 172.16 MDL Number: MFCD00149625 InChI Key: PASHVRUKOFIRIK-UHFFFAOYSA-L Synonym: calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone PubChem CID: 24928 ChEBI: CHEBI:32583 IUPAC Name: calcium;sulfate;dihydrate SMILES: O.O.[Ca++].[O-]S([O-])(=O)=O
| PubChem CID | 24928 |
|---|---|
| CAS | 10101-41-4 |
| Molecular Weight (g/mol) | 172.16 |
| ChEBI | CHEBI:32583 |
| MDL Number | MFCD00149625 |
| SMILES | O.O.[Ca++].[O-]S([O-])(=O)=O |
| Synonym | calcium sulfate dihydrate,phosphogypsum,landplaster,annaline,compactrol,gips,gypsite,primoplast,satinite,gypsum stone |
| IUPAC Name | calcium;sulfate;dihydrate |
| InChI Key | PASHVRUKOFIRIK-UHFFFAOYSA-L |
| Molecular Formula | CaH4O6S |